EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9N4O2S |
| Net Charge | -1 |
| Average Mass | 249.275 |
| Monoisotopic Mass | 249.04517 |
| SMILES | Nc1ccc(S(=O)(=O)[N-]c2ncccn2)cc1 |
| InChI | InChI=1S/C10H9N4O2S/c11-8-2-4-9(5-3-8)17(15,16)14-10-12-6-1-7-13-10/h1-7H,11H2/q-1 |
| InChIKey | SEJJCMKIFGUACV-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfadiazinate (CHEBI:33127) is a organic nitrogen anion (CHEBI:50335) |
| sulfadiazinate (CHEBI:33127) is conjugate base of sulfadiazine (CHEBI:9328) |
| Incoming Relation(s) |
| silver(1+) sulfadiazinate (CHEBI:9142) has part sulfadiazinate (CHEBI:33127) |
| sulfadiazine (CHEBI:9328) is conjugate acid of sulfadiazinate (CHEBI:33127) |
| IUPAC Name |
|---|
| [(4-aminophenyl)sulfonyl](pyrimidin-2-yl)azanide |
| UniProt Name | Source |
|---|---|
| sulfadiazine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:332468 | Gmelin |
| Beilstein:4148387 | Beilstein |