EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H3BO3 |
| Net Charge | 0 |
| Average Mass | 61.833 |
| Monoisotopic Mass | 62.01752 |
| SMILES | [H]OB(O[H])O[H] |
| InChI | InChI=1S/BH3O3/c2-1(3)4/h2-4H |
| InChIKey | KGBXLFKZBHKPEV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | plastic heat stabilizer an additive to plastics that protects them against thermal stress during processing and extends the life of the final product inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | plastic heat stabilizer an additive to plastics that protects them against thermal stress during processing and extends the life of the final product astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| boric acid (CHEBI:33118) has role astringent (CHEBI:74783) |
| boric acid (CHEBI:33118) has role plastic heat stabilizer (CHEBI:747338) |
| boric acid (CHEBI:33118) is a boric acids (CHEBI:59765) |
| boric acid (CHEBI:33118) is conjugate acid of dihydrogenborate (CHEBI:29254) |
| Incoming Relation(s) |
| borates (CHEBI:22910) has functional parent boric acid (CHEBI:33118) |
| hydroperoxo(trihydroxo)borate(1−) (CHEBI:30177) has functional parent boric acid (CHEBI:33118) |
| dihydrogenborate (CHEBI:29254) is conjugate base of boric acid (CHEBI:33118) |
| IUPAC Name |
|---|
| trihydroxidoboron |
| Synonyms | Source |
|---|---|
| [B(OH)3] | MolBase |
| B(OH)3 | NIST Chemistry WebBook |
| boric acid | IUPAC |
| Boric acid | KEGG COMPOUND |
| BORIC ACID | PDBeChem |
| boron trihydroxide | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1585 | Gmelin |
| CAS:10043-35-3 | KEGG COMPOUND |
| CAS:10043-35-3 | NIST Chemistry WebBook |
| CAS:10043-35-3 | ChemIDplus |
| CAS:11113-50-1 | ChemIDplus |