EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HO6S4 |
| Net Charge | -1 |
| Average Mass | 225.270 |
| Monoisotopic Mass | 224.86615 |
| SMILES | O=S(=O)([O-])SSS(=O)(=O)O |
| InChI | InChI=1S/H2O6S4/c1-9(2,3)7-8-10(4,5)6/h(H,1,2,3)(H,4,5,6)/p-1 |
| InChIKey | HPQYKCJIWQFJMS-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrathionate(1−) (CHEBI:33113) is a tetrathionate ion (CHEBI:26936) |
| tetrathionate(1−) (CHEBI:33113) is conjugate acid of tetrathionate(2−) (CHEBI:15226) |
| tetrathionate(1−) (CHEBI:33113) is conjugate base of tetrathionic acid (CHEBI:16853) |
| Incoming Relation(s) |
| tetrathionic acid (CHEBI:16853) is conjugate acid of tetrathionate(1−) (CHEBI:33113) |
| tetrathionate(2−) (CHEBI:15226) is conjugate base of tetrathionate(1−) (CHEBI:33113) |
| IUPAC Name |
|---|
| 3-hydroxytrisulfane-1-sulfonate 3,3-dioxide |
| Synonym | Source |
|---|---|
| hydrogen tetrathionate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:327222 | Gmelin |