EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C2H3O2.Ca |
| Net Charge | 0 |
| Average Mass | 158.166 |
| Monoisotopic Mass | 157.98920 |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C2H4O2.Ca/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | VSGNNIFQASZAOI-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Role: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calcium acetate (CHEBI:3310) has part acetate (CHEBI:30089) |
| calcium acetate (CHEBI:3310) has role chelator (CHEBI:38161) |
| calcium acetate (CHEBI:3310) has role geroprotector (CHEBI:176497) |
| calcium acetate (CHEBI:3310) has role renoprotective agent (CHEBI:231911) |
| calcium acetate (CHEBI:3310) is a calcium salt (CHEBI:35156) |
| Incoming Relation(s) |
| calcium acetate monohydrate (CHEBI:59199) has part calcium acetate (CHEBI:3310) |
| IUPAC Name |
|---|
| calcium diacetate |
| Synonyms | Source |
|---|---|
| acetate of lime | ChemIDplus |
| Acetic acid, calcium salt | ChEMBL |
| Acetic acid, calcium salt (2:1) | ChEMBL |
| brown acetate of lime | ChemIDplus |
| Calcarea acetica | ChEMBL |
| Calcium acetate anhydrous | ChEMBL |
| Brand Names | Source |
|---|---|
| Calcium acetate component of procalamine | ChEMBL |
| Eliphos | ChEMBL |
| Everose | ChEMBL |
| Phosex | ChEMBL |
| Phoslo | ChEMBL |
| Phoslo gelcaps | ChEMBL |
| Citations |
|---|