EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO2 |
| Net Charge | 0 |
| Average Mass | 137.138 |
| Monoisotopic Mass | 137.04768 |
| SMILES | Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7NO2/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3 |
| InChIKey | PLAZTCDQAHEYBI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-nitrotoluene (CHEBI:33098) has role carcinogenic agent (CHEBI:50903) |
| 2-nitrotoluene (CHEBI:33098) has role environmental contaminant (CHEBI:78298) |
| 2-nitrotoluene (CHEBI:33098) is a mononitrotoluene (CHEBI:63171) |
| IUPAC Name |
|---|
| 1-methyl-2-nitrobenzene |
| Synonyms | Source |
|---|---|
| 2-methyl-1-nitrobenzene | ChemIDplus |
| 2-Nitrotoluol | ChemIDplus |
| o-methylnitrobenzene | ChemIDplus |
| o-nitrotoluene | ChemIDplus |
| o-Nitrotoluol | ChEBI |
| ortho-Nitrotoluol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-nitrotoluene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2-Nitrotoluene | Wikipedia |
| 2-NITROTOLUENE | MetaCyc |
| C19597 | KEGG COMPOUND |
| Citations |
|---|