EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10 |
| Net Charge | 0 |
| Average Mass | 202.256 |
| Monoisotopic Mass | 202.07825 |
| SMILES | c1ccc2c(c1)-c1cccc3cccc-2c13 |
| InChI | InChI=1S/C16H10/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14/h1-10H |
| InChIKey | GVEPBJHOBDJJJI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluoranthene (CHEBI:33083) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| Incoming Relation(s) |
| 7,10-bis(4-bromophenyl)-8-nonyl-9-octylfluoranthene (CHEBI:48303) has parent hydride fluoranthene (CHEBI:33083) |
| 7,10-bis(4-bromophenyl)-8,9-bis(4-octylphenyl)fluoranthene (CHEBI:48302) has parent hydride fluoranthene (CHEBI:33083) |
| 7,10-bis(4-bromophenyl)-8,9-diphenylfluoranthene (CHEBI:48301) has parent hydride fluoranthene (CHEBI:33083) |
| IUPAC Name |
|---|
| fluoranthene |
| Synonym | Source |
|---|---|
| benzo[jk]fluorene | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C19425 | KEGG COMPOUND |
| CPD-15564 | MetaCyc |
| Fluoranthene | Wikipedia |
| Citations |
|---|