EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8 |
| Net Charge | 0 |
| Average Mass | 152.196 |
| Monoisotopic Mass | 152.06260 |
| SMILES | C1=Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C12H8/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-8H |
| InChIKey | HXGDTGSAIMULJN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acenaphthylene (CHEBI:33081) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| acenaphthylene (CHEBI:33081) is a ortho- and peri-fused tricyclic hydrocarbon (CHEBI:51120) |
| acenaphthylene (CHEBI:33081) is a acenaphthylenes (CHEBI:38033) |
| IUPAC Name |
|---|
| acenaphthylene |
| Synonym | Source |
|---|---|
| cyclopenta[de]naphthalene | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| Acenaphthylene | Wikipedia |
| Citations |
|---|