EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12 |
| Net Charge | 0 |
| Average Mass | 228.294 |
| Monoisotopic Mass | 228.09390 |
| SMILES | c1ccc2c(c1)c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C18H12/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18/h1-12H |
| InChIKey | SLGBZMMZGDRARJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triphenylene (CHEBI:33080) is a ortho-fused polycyclic arene (CHEBI:35296) |
| IUPAC Name |
|---|
| triphenylene |
| Synonyms | Source |
|---|---|
| isochrysene | NIST Chemistry WebBook |
| 9,10-benzophenanthrene | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C19541 | KEGG COMPOUND |
| Triphenylene | Wikipedia |
| Citations |
|---|