EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8 |
| Net Charge | 0 |
| Average Mass | 152.196 |
| Monoisotopic Mass | 152.06260 |
| SMILES | c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/C12H8/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h1-8H |
| InChIKey | IFVTZJHWGZSXFD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biphenylene (CHEBI:33079) is a ortho-fused polycyclic arene (CHEBI:35296) |
| biphenylene (CHEBI:33079) is a ortho-fused tricyclic hydrocarbon (CHEBI:37089) |
| IUPAC Name |
|---|
| biphenylene |
| Synonyms | Source |
|---|---|
| 1,1'-biphenylene | NIST Chemistry WebBook |
| cyclobutadibenzene | ChemIDplus |
| dibenzocyclobutadiene | NIST Chemistry WebBook |
| diphenylene | ChemIDplus |