EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H3O6 |
| Net Charge | -3 |
| Average Mass | 207.117 |
| Monoisotopic Mass | 206.99461 |
| SMILES | O=C([O-])c1cc(C(=O)[O-])cc(C(=O)[O-])c1 |
| InChI | InChI=1S/C9H6O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15)/p-3 |
| InChIKey | QMKYBPDZANOJGF-UHFFFAOYSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzene-1,3,5-tricarboxylate(3−) (CHEBI:33059) is a tricarboxylic acid trianion (CHEBI:27092) |
| benzene-1,3,5-tricarboxylate(3−) (CHEBI:33059) is conjugate base of benzene-1,3,5-tricarboxylate(2−) (CHEBI:33060) |
| Incoming Relation(s) |
| benzene-1,3,5-tricarboxylate(2−) (CHEBI:33060) is conjugate acid of benzene-1,3,5-tricarboxylate(3−) (CHEBI:33059) |
| IUPAC Name |
|---|
| benzene-1,3,5-tricarboxylate |
| Registry Numbers | Sources |
|---|---|
| Gmelin:330147 | Gmelin |
| Beilstein:4146066 | Beilstein |