EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17N3O7 |
| Net Charge | 0 |
| Average Mass | 399.359 |
| Monoisotopic Mass | 399.10665 |
| SMILES | O=C(N[C@H]1CN([C@@H](C(=O)O)c2ccc(O)cc2)C1=O)/C(=N/O)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H17N3O7/c23-12-5-1-10(2-6-12)15(21-29)17(25)20-14-9-22(18(14)26)16(19(27)28)11-3-7-13(24)8-4-11/h1-8,14,16,23-24,29H,9H2,(H,20,25)(H,27,28)/b21-15+/t14-,16+/m0/s1 |
| InChIKey | NMMOYDKOFASOBV-ORWLQXDRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nocardicin F (CHEBI:33012) is a monocarboxylic acid (CHEBI:25384) |
| nocardicin F (CHEBI:33012) is a nocardicin (CHEBI:25572) |
| IUPAC Name |
|---|
| (2R)-{(3S)-3-[(2E)-2-(hydroxyimino)-2-(4-hydroxyphenyl)acetamido]-2-oxoazetidin-1-yl}(4-hydroxyphenyl)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| C17354 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3598527 | Beilstein |
| CAS:63598-46-9 | ChemIDplus |
| CAS:63598-46-9 | KEGG COMPOUND |