EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO4 |
| Net Charge | 0 |
| Average Mass | 171.152 |
| Monoisotopic Mass | 171.05316 |
| SMILES | O=C(O)C1=N[C@@H](C(=O)O)CCC1 |
| InChI | InChI=1S/C7H9NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h4H,1-3H2,(H,9,10)(H,11,12)/t4-/m1/s1 |
| InChIKey | CXMBCXQHOXUCEO-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2,3,4,5-tetrahydrodipicolinic acid (CHEBI:32975) is a 2,3,4,5-tetrahydrodipicolinic acid (CHEBI:32976) |
| IUPAC Name |
|---|
| (2R)-2,3,4,5-tetrahydropyridine-2,6-dicarboxylic acid |
| Synonym | Source |
|---|---|
| D-2,3,4,5-tetrahydrodipicolinic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8684703 | Beilstein |