EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H60O |
| Net Charge | 0 |
| Average Mass | 424.798 |
| Monoisotopic Mass | 424.46442 |
| SMILES | CCCCCCCCCCCCCCCCCCC[C@@H](O)CCCCCCCCC |
| InChI | InChI=1S/C29H60O/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26-28-29(30)27-25-23-21-10-8-6-4-2/h29-30H,3-28H2,1-2H3/t29-/m0/s1 |
| InChIKey | CPGCVOVWHCWVTP-LJAQVGFWSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-nonacosan-10-ol (CHEBI:32948) is a nonacosan-10-ol (CHEBI:7611) |
| (S)-nonacosan-10-ol (CHEBI:32948) is enantiomer of (R)-nonacosan-10-ol (CHEBI:32947) |
| Incoming Relation(s) |
| (R)-nonacosan-10-ol (CHEBI:32947) is enantiomer of (S)-nonacosan-10-ol (CHEBI:32948) |
| IUPAC Name |
|---|
| (10S)-nonacosan-10-ol |
| Synonym | Source |
|---|---|
| Ginnol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001261 | KNApSAcK |
| C08385 | KEGG COMPOUND |
| LMFA05000088 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6684820 | Beilstein |
| CAS:2606-50-0 | KEGG COMPOUND |