EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3291 - cafestol
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@@]1(CC[C@]1([H])c4ccoc4CC[C@@]21C)C[C@]3(O)CO |
| InChI | InChI=1S/C20H28O3/c1-18-7-5-16-14(6-9-23-16)15(18)4-8-19-10-13(2-3-17(18)19)20(22,11-19)12-21/h6,9,13,15,17,21-22H,2-5,7-8,10-12H2,1H3/t13-,15-,17+,18-,19+,20+/m1/s1 |
| InChIKey | DNJVYWXIDISQRD-HWUKTEKMSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coffea arabica (ncbitaxon:13443) | - | Article (Clarke, R.J. and Macrae, R. (2013). <i>Coffee Volume 1: Chemistry</i>. Springer, New York. ISBN 978-9401086936) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cafestol (CHEBI:3291) has role angiogenesis inhibitor (CHEBI:48422) |
| cafestol (CHEBI:3291) has role anti-inflammatory agent (CHEBI:67079) |
| cafestol (CHEBI:3291) has role antineoplastic agent (CHEBI:35610) |
| cafestol (CHEBI:3291) has role antioxidant (CHEBI:22586) |
| cafestol (CHEBI:3291) has role apoptosis inducer (CHEBI:68495) |
| cafestol (CHEBI:3291) has role hypoglycemic agent (CHEBI:35526) |
| cafestol (CHEBI:3291) has role plant metabolite (CHEBI:76924) |
| cafestol (CHEBI:3291) is a diterpenoid (CHEBI:23849) |
| cafestol (CHEBI:3291) is a furans (CHEBI:24129) |
| cafestol (CHEBI:3291) is a organic heteropentacyclic compound (CHEBI:38164) |
| cafestol (CHEBI:3291) is a primary alcohol (CHEBI:15734) |
| cafestol (CHEBI:3291) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S,4S,12S,13R,16R,17R)-17-(hydroxymethyl)-12-methyl-8-oxapentacyclo[14.2.1.01,13.04,12.05,9]nonadeca-5(9),6-dien-17-ol |
| Synonym | Source |
|---|---|
| (−)-cafestol | ChEBI |
| Citations |
|---|