EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O5 |
| Net Charge | 0 |
| Average Mass | 346.423 |
| Monoisotopic Mass | 346.17802 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]2(C=O)CCC[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C20H26O5/c1-11-8-20-9-12(11)4-5-13(20)19(10-21)7-3-6-18(2,17(24)25)15(19)14(20)16(22)23/h10,12-15H,1,3-9H2,2H3,(H,22,23)(H,24,25)/t12-,13+,14-,15-,18-,19-,20+/m1/s1 |
| InChIKey | QQRSSHFHXYSOMF-CXXOJBQZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A24 (CHEBI:32906) has role plant metabolite (CHEBI:76924) |
| gibberellin A24 (CHEBI:32906) is a aldehyde (CHEBI:17478) |
| gibberellin A24 (CHEBI:32906) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A24 (CHEBI:32906) is a dicarboxylic acid (CHEBI:35692) |
| gibberellin A24 (CHEBI:32906) is conjugate acid of gibberellin A24(2−) (CHEBI:143957) |
| Incoming Relation(s) |
| gibberellin A24(2−) (CHEBI:143957) is conjugate base of gibberellin A24 (CHEBI:32906) |
| IUPAC Names |
|---|
| (1R,2S,3S,4R,8R,9R,12R)-8-formyl-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid |
| 4a-formyl-1β-methyl-8-methylidene-4aα,4bβ-gibbane-1α,10β-dicarboxylic acid |
| (1R,4aR,4bR,7R,9aR,10S,10aS)-4a-formyl-1-methyl-8-methylidene-1,2,3,4,4a,5,6,7,8,9,10a-dodecahydro-10H-benzo[a]azulene-1,10-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| gibberellin 24 | ChEBI |
| Gibberellin A24 | KEGG COMPOUND |
| GA24 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C11861 | KEGG COMPOUND |
| LMPR0104170018 | LIPID MAPS |
| C00000024 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2822982 | Reaxys |
| CAS:19427-32-8 | KEGG COMPOUND |
| CAS:19427-32-8 | ChemIDplus |
| Citations |
|---|