EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O5 |
| Net Charge | 0 |
| Average Mass | 330.380 |
| Monoisotopic Mass | 330.14672 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]23C=C[C@H](O)[C@@]1(C)C(=O)O3 |
| InChI | InChI=1S/C19H22O5/c1-9-7-18-8-10(9)3-4-11(18)19-6-5-12(20)17(2,16(23)24-19)14(19)13(18)15(21)22/h5-6,10-14,20H,1,3-4,7-8H2,2H3,(H,21,22)/t10-,11-,12+,13-,14-,17-,18+,19-/m1/s1 |
| InChIKey | SEEGHKWOBVVBTQ-NFMPGMCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gibberella fujikuroi (ncbitaxon:5127) | - | PubMed (24232845) | |
| Leifsonia soli (ncbitaxon:582665) | - | PubMed (24569847) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A7 (CHEBI:32903) has role bacterial metabolite (CHEBI:76969) |
| gibberellin A7 (CHEBI:32903) has role mouse metabolite (CHEBI:75771) |
| gibberellin A7 (CHEBI:32903) has role plant metabolite (CHEBI:76924) |
| gibberellin A7 (CHEBI:32903) is a C19-gibberellin (CHEBI:20858) |
| gibberellin A7 (CHEBI:32903) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A7 (CHEBI:32903) is a lactone (CHEBI:25000) |
| IUPAC Names |
|---|
| (1R,2R,5R,8R,9S,10R,11S,12S)-12-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid |
| (1S,2S,4aR,4bR,7R,9aR,10S,10aR)-2-hydroxy-1-methyl-8-methylidene-13-oxo-1,2,4b,5,6,7,8,9,10,10a-decahydro-4a,1-(epoxymethano)-7,9a-methanobenzo[a]azulene-10-carboxylic acid |
| 2β-hydroxy-1β-methyl-8-methylidene-13-oxo-4a,1α-epoxymethano-4aα,4bβ-gibb-3-ene-10β-carboxylic acid |
| Synonyms | Source |
|---|---|
| (1α,2β,4aα,4bβ,10β)-2,4a-dihydroxy-1-methyl-8-methylenegibb-3-ene-1,10-dicarboxylic acid 1,4a-lactone | ChemIDplus |
| GA7 | ChEBI |
| gibberellin 7 | ChEBI |
| Gibberellin A7 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000007 | KNApSAcK |
| C11867 | KEGG COMPOUND |
| LMPR0104170024 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1439710 | Beilstein |
| Beilstein:8359138 | Beilstein |
| CAS:510-75-8 | ChemIDplus |
| CAS:510-75-8 | KEGG COMPOUND |
| Citations |
|---|