EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6Cl6 |
| Net Charge | 0 |
| Average Mass | 290.832 |
| Monoisotopic Mass | 287.86007 |
| SMILES | Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H]1Cl |
| InChI | InChI=1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H/t1-,2-,3-,4+,5+,6+ |
| InChIKey | JLYXXMFPNIAWKQ-GNIYUCBRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Biological Roles: | fungicide A substance used to destroy fungal pests. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | rodenticide A substance used to destroy rodent pests. pediculicide Substance used to treat lice (genus Pediculus) infestation. fungicide A substance used to destroy fungal pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-hexachlorocyclohexane (CHEBI:32888) has role agrochemical (CHEBI:33286) |
| γ-hexachlorocyclohexane (CHEBI:32888) has role antibacterial agent (CHEBI:33282) |
| γ-hexachlorocyclohexane (CHEBI:32888) has role ectoparasiticide (CHEBI:38956) |
| γ-hexachlorocyclohexane (CHEBI:32888) has role fungicide (CHEBI:24127) |
| γ-hexachlorocyclohexane (CHEBI:32888) has role GABA-gated chloride channel antagonist (CHEBI:38999) |
| γ-hexachlorocyclohexane (CHEBI:32888) has role pediculicide (CHEBI:38706) |
| γ-hexachlorocyclohexane (CHEBI:32888) has role persistent organic pollutant (CHEBI:77853) |
| γ-hexachlorocyclohexane (CHEBI:32888) has role rodenticide (CHEBI:33288) |
| γ-hexachlorocyclohexane (CHEBI:32888) is a cyclodiene organochlorine insecticide (CHEBI:23457) |
| γ-hexachlorocyclohexane (CHEBI:32888) is a hexachlorocyclohexane (CHEBI:24536) |
| IUPAC Name |
|---|
| (1r,2R,3S,4r,5R,6S)-1,2,3,4,5,6-hexachlorocyclohexane |
| Synonyms | Source |
|---|---|
| 1,2,3,4,5,6-Hexachlorocyclohexane | KEGG COMPOUND |
| (1r,2c,3t,4c,5c,6t)-1,2,3,4,5,6-hexachlorocyclohexane | IUPAC |
| (1α,2α,3β,4α,5α,6β)-1,2,3,4,5,6-hexachlorocyclohexane | NIST Chemistry WebBook |
| Benzene hexachloride | KEGG COMPOUND |
| gamma-BHC | KEGG COMPOUND |
| gamma-HCH | ChEBI |
| UniProt Name | Source |
|---|---|
| γ-hexachlorocyclohexane | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1907337 | Beilstein |
| Gmelin:2179629 | Gmelin |
| CAS:55963-79-6 | NIST Chemistry WebBook |
| CAS:58-89-9 | KEGG COMPOUND |
| CAS:58-89-9 | ChemIDplus |
| CAS:58-89-9 | NIST Chemistry WebBook |
| CAS:58-89-9 | KEGG COMPOUND |
| Citations |
|---|