EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N2O4 |
| Net Charge | 0 |
| Average Mass | 382.460 |
| Monoisotopic Mass | 382.18926 |
| SMILES | [H][C@@]12C[C@]3([H])C(C(=O)OC)=CO[C@@H](C)[C@@]3([H])CN1CCc1c2nc2ccc(OC)cc12 |
| InChI | InChI=1S/C22H26N2O4/c1-12-17-10-24-7-6-14-16-8-13(26-2)4-5-19(16)23-21(14)20(24)9-15(17)18(11-28-12)22(25)27-3/h4-5,8,11-12,15,17,20,23H,6-7,9-10H2,1-3H3/t12-,15-,17+,20-/m0/s1 |
| InChIKey | DTDADHMBRZKXSC-IEGSVRCHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cabucine (CHEBI:3287) is a yohimban alkaloid (CHEBI:27358) |
| Synonym | Source |
|---|---|
| Cabucine | KEGG COMPOUND |