EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H37N5O2 |
| Net Charge | 0 |
| Average Mass | 451.615 |
| Monoisotopic Mass | 451.29473 |
| SMILES | [H][C@@]12Cc3cnc4cccc(c34)[C@@]1([H])C[C@@H](C(=O)N(CCCN(C)C)C(=O)NCC)CN2CC=C |
| InChI | InChI=1S/C26H37N5O2/c1-5-11-30-17-19(25(32)31(26(33)27-6-2)13-8-12-29(3)4)14-21-20-9-7-10-22-24(20)18(16-28-22)15-23(21)30/h5,7,9-10,16,19,21,23,28H,1,6,8,11-15,17H2,2-4H3,(H,27,33)/t19-,21-,23-/m1/s1 |
| InChIKey | KORNTPPJEAJQIU-KJXAQDMKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | dopamine agonist A drug that binds to and activates dopamine receptors. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. dopamine agonist A drug that binds to and activates dopamine receptors. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cabergoline (CHEBI:3286) has role antineoplastic agent (CHEBI:35610) |
| cabergoline (CHEBI:3286) has role antiparkinson drug (CHEBI:48407) |
| cabergoline (CHEBI:3286) has role dopamine agonist (CHEBI:51065) |
| cabergoline (CHEBI:3286) is a N-acylurea (CHEBI:74266) |
| IUPAC Name |
|---|
| (8β)-N-[3-(dimethylamino)propyl]-N-(ethylcarbamoyl)-6-(prop-2-en-1-yl)ergoline-8-carboxamide |
| INNs | Source |
|---|---|
| cabergoline | ChemIDplus |
| cabergolina | ChemIDplus |
| cabergolinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Cabergoline | KEGG COMPOUND |
| (8β)-N-[3-(dimethylamino)propyl]-N-[(ethylamino)carbonyl]-6-(2-propenyl)-ergoline-8-carboxamide | ChEBI |
| 1-ethyl-3-(3'-dimethylamionpropyl)-2-(6'-allylergoline-8'β-carbonyl)urea | ChEBI |
| 1-[(6-allylergoline-8β-yl)carbonyl]-1-[3-(dimethylamino)propyl]-3-ethylurea | ChEBI |
| 1-((6-allylergolin-8β-yl)carbonyl)-1-(3-(dimethylamino)propyl)-3-ethylurea | ChemIDplus |
| (8R)-6-allyl-N-[3-(dimethylamino)propyl]-N-(ethylcarbamoyl)ergoline-8-carboxamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08187 | KEGG COMPOUND |
| D00987 | KEGG DRUG |
| DB00248 | DrugBank |
| BE888243 | Patent |
| US4526892 | Patent |
| Cabergoline | Wikipedia |
| HMDB0014393 | HMDB |
| LSM-3939 | LINCS |
| 460 | DrugCentral |
| 1830 | VSDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6020775 | Beilstein |
| CAS:81409-90-7 | KEGG COMPOUND |
| CAS:81409-90-7 | ChemIDplus |
| Citations |
|---|