EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H16N2 |
| Net Charge | 0 |
| Average Mass | 116.208 |
| Monoisotopic Mass | 116.13135 |
| SMILES | CN(C)CCN(C)C |
| InChI | InChI=1S/C6H16N2/c1-7(2)5-6-8(3)4/h5-6H2,1-4H3 |
| InChIKey | KWYHDKDOAIKMQN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N,N',N'-tetramethylethylenediamine (CHEBI:32850) has role catalyst (CHEBI:35223) |
| N,N,N',N'-tetramethylethylenediamine (CHEBI:32850) has role chelator (CHEBI:38161) |
| N,N,N',N'-tetramethylethylenediamine (CHEBI:32850) is a ethylenediamine derivative (CHEBI:31577) |
| IUPAC Name |
|---|
| N,N,N',N'-tetramethylethane-1,2-diamine |
| Synonyms | Source |
|---|---|
| N,N,N',N'-tetramethylethylenediamine | ChemIDplus |
| N,N,N',N'-tetramethyl-1,2-ethanediamine | NIST Chemistry WebBook |
| tmen | IUPAC |
| TMEDA | ChemIDplus |
| tetramethyldiaminoethane | ChemIDplus |
| TEMED | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Tetramethylethylenediamine | Wikipedia |
| Citations |
|---|