EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8NO5 |
| Net Charge | -1 |
| Average Mass | 162.121 |
| Monoisotopic Mass | 162.04080 |
| SMILES | [NH3+][C@@H](CC(O)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C5H9NO5/c6-2(4(8)9)1-3(7)5(10)11/h2-3,7H,1,6H2,(H,8,9)(H,10,11)/p-1/t2-,3?/m0/s1 |
| InChIKey | HBDWQSHEVMSFGY-SCQFTWEKSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-L-glutamate(1−) (CHEBI:32812) has functional parent L-glutamate(1−) (CHEBI:29985) |
| 4-hydroxy-L-glutamate(1−) (CHEBI:32812) is a L-α-amino acid anion (CHEBI:59814) |
| 4-hydroxy-L-glutamate(1−) (CHEBI:32812) is conjugate acid of 4-hydroxy-L-glutamate(2−) (CHEBI:16338) |
| 4-hydroxy-L-glutamate(1−) (CHEBI:32812) is conjugate base of 4-hydroxy-L-glutamic acid (CHEBI:32811) |
| Incoming Relation(s) |
| 4-hydroxy-L-glutamic acid (CHEBI:32811) is conjugate acid of 4-hydroxy-L-glutamate(1−) (CHEBI:32812) |
| 4-hydroxy-L-glutamate(2−) (CHEBI:16338) is conjugate base of 4-hydroxy-L-glutamate(1−) (CHEBI:32812) |
| 4-hydroxy-L-glutamate residue (CHEBI:141845) is substituent group from 4-hydroxy-L-glutamate(1−) (CHEBI:32812) |
| IUPAC Names |
|---|
| (2S)-2-azaniumyl-4-hydroxypentanedioate |
| hydrogen 4-hydroxy-L-glutamate |
| Synonym | Source |
|---|---|
| (2S)-2-ammonio-4-hydroxypentanedioate | IUPAC |
| UniProt Name | Source |
|---|---|
| 4-hydroxy-L-glutamate | UniProt |