EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10FNO3 |
| Net Charge | 0 |
| Average Mass | 199.181 |
| Monoisotopic Mass | 199.06447 |
| SMILES | N[C@H](Cc1ccc(O)c(F)c1)C(=O)O |
| InChI | InChI=1S/C9H10FNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14)/t7-/m1/s1 |
| InChIKey | VIIAUOZUUGXERI-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-fluoro-D-tyrosine (CHEBI:32770) is a D-tyrosine derivative (CHEBI:84124) |
| 3-fluoro-D-tyrosine (CHEBI:32770) is a D-α-amino acid (CHEBI:16733) |
| 3-fluoro-D-tyrosine (CHEBI:32770) is a monofluorobenzenes (CHEBI:83575) |
| IUPAC Name |
|---|
| 3-fluoro-D-tyrosine |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-(3-fluoro-4-hydroxyphenyl)propanoic acid | IUPAC |
| D-3-fluorotyrosine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3204803 | Beilstein |
| CAS:64024-06-2 | ChemIDplus |