EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO3 |
| Net Charge | -2 |
| Average Mass | 179.175 |
| Monoisotopic Mass | 179.05934 |
| SMILES | N[C@@H](Cc1ccc([O-])cc1)C(=O)[O-] |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/p-2/t8-/m0/s1 |
| InChIKey | OUYCCCASQSFEME-QMMMGPOBSA-L |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-tyrosinate(2−) (CHEBI:32761) has role fundamental metabolite (CHEBI:78675) |
| L-tyrosinate(2−) (CHEBI:32761) is a tyrosinate(2−) (CHEBI:32785) |
| L-tyrosinate(2−) (CHEBI:32761) is conjugate base of L-tyrosinate(1−) (CHEBI:32760) |
| L-tyrosinate(2−) (CHEBI:32761) is enantiomer of D-tyrosinate(2−) (CHEBI:32774) |
| Incoming Relation(s) |
| disodium L-tyrosinate (CHEBI:53696) has part L-tyrosinate(2−) (CHEBI:32761) |
| L-tyrosinate(1−) (CHEBI:32760) is conjugate acid of L-tyrosinate(2−) (CHEBI:32761) |
| D-tyrosinate(2−) (CHEBI:32774) is enantiomer of L-tyrosinate(2−) (CHEBI:32761) |
| IUPAC Name |
|---|
| L-tyrosinate |
| Synonyms | Source |
|---|---|
| L-tyrosinate(2−) | JCBN |
| L-tyrosine dianion | JCBN |
| (2S)-2-amino-3-(4-oxidophenyl)propanoate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:364975 | Gmelin |
| Reaxys:5339596 | Reaxys |