EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N2O2 |
| Net Charge | 0 |
| Average Mass | 203.221 |
| Monoisotopic Mass | 203.08205 |
| SMILES | *n1cc(C[C@H](N)C(=O)O)c2ccccc21 |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-L-tryptophano group (CHEBI:32710) is a 1-tryptophano group (CHEBI:32731) |
| 1-L-tryptophano group (CHEBI:32710) is enantiomer of 1-D-tryptophano group (CHEBI:32720) |
| 1-L-tryptophano group (CHEBI:32710) is substituent group from L-tryptophan (CHEBI:16828) |
| Incoming Relation(s) |
| 1-D-tryptophano group (CHEBI:32720) is enantiomer of 1-L-tryptophano group (CHEBI:32710) |
| IUPAC Name |
|---|
| 3-[(2S)-2-amino-2-carboxyethyl]-1H-indol-1-yl |
| Synonyms | Source |
|---|---|
| 1-L-tryptophano | JCBN |
| L-tryptophan-1-yl | JCBN |