EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O5 |
| Net Charge | 0 |
| Average Mass | 338.444 |
| Monoisotopic Mass | 338.20932 |
| SMILES | CCCCOCCOCCOCc1cc2c(cc1CCC)OCO2 |
| InChI | InChI=1S/C19H30O5/c1-3-5-7-20-8-9-21-10-11-22-14-17-13-19-18(23-15-24-19)12-16(17)6-4-2/h12-13H,3-11,14-15H2,1-2H3 |
| InChIKey | FIPWRIJSWJWJAI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | pesticide synergist A substance that increases the efficacy of a pesticide. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piperonyl butoxide (CHEBI:32687) has role pesticide synergist (CHEBI:25943) |
| piperonyl butoxide (CHEBI:32687) is a benzodioxoles (CHEBI:38298) |
| IUPAC Name |
|---|
| 5-{[2-(2-butoxyethoxy)ethoxy]methyl}-6-propyl-1,3-benzodioxole |
| Synonyms | Source |
|---|---|
| (butylcarbityl)(6-propylpiperonyl)ether | ChemIDplus |
| 2-(2-butoxyethoxy)ethyl 6-propylpiperonyl ether | ChemIDplus |
| α-[2-(2-butoxyethoxy)ethoxy]-4,5-(methylenedioxy)-2-propyltoluene | NIST Chemistry WebBook |
| 5-propyl-4-(2,5,8-trioxa-dodecyl)-1,3-benzodioxole | NIST Chemistry WebBook |
| butyl carbitol 6-propylpiperonyl ether | ChemIDplus |
| 6-propylpiperonyl butyl diethylene glycol ether | NIST Chemistry WebBook |