EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2Ca.O7P2 |
| Net Charge | 0 |
| Average Mass | 254.097 |
| Monoisotopic Mass | 253.83711 |
| SMILES | O=P([O-])([O-])OP(=O)([O-])[O-].[Ca+2].[Ca+2] |
| InChI | InChI=1S/2Ca.H4O7P2/c;;1-8(2,3)7-9(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q2*+2;/p-4 |
| InChIKey | JUNWLZAGQLJVLR-UHFFFAOYSA-J |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | nutrient A nutrient is a food component that an organism uses to survive and grow. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calcium diphosphate (CHEBI:32598) has part diphosphate(4−) (CHEBI:18361) |
| calcium diphosphate (CHEBI:32598) is a calcium phosphate (CHEBI:77635) |
| IUPAC Name |
|---|
| calcium diphosphate |
| Synonyms | Source |
|---|---|
| calcium pyrophosphate | ChEBI |
| Ca2P2O7 | IUPAC |
| diphosphoric acid, calcium salt (2:1) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Calcium_phosphate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:35405-51-7 | ChemIDplus |