EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H5ClN4 |
| Net Charge | 0 |
| Average Mass | 204.620 |
| Monoisotopic Mass | 204.02027 |
| SMILES | N#CC(C#N)=NNc1cccc(Cl)c1 |
| InChI | InChI=1S/C9H5ClN4/c10-7-2-1-3-8(4-7)13-14-9(5-11)6-12/h1-4,13H |
| InChIKey | UGTJLJZQQFGTJD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | ionophore A compound which can carry specific ions through membranes of cells or organelles. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CCCP (CHEBI:3259) has functional parent hydrazonomalononitrile (CHEBI:33189) |
| CCCP (CHEBI:3259) has role antibacterial agent (CHEBI:33282) |
| CCCP (CHEBI:3259) has role geroprotector (CHEBI:176497) |
| CCCP (CHEBI:3259) has role ionophore (CHEBI:24869) |
| CCCP (CHEBI:3259) is a hydrazone (CHEBI:38532) |
| CCCP (CHEBI:3259) is a monochlorobenzenes (CHEBI:83403) |
| CCCP (CHEBI:3259) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| N'-(3-chlorophenyl)carbonohydrazonoyl dicyanide |
| Synonyms | Source |
|---|---|
| CCCP | KEGG COMPOUND |
| Carbonyl cyanide m-chlorophenyl hydrazone | KEGG COMPOUND |
| (3-chlorophenyl)hydrazonomalononitrile | ChemIDplus |
| [(3-chlorophenyl)hydrazono]malononitrile | ChemIDplus |
| carbonylcyanide-3-chlorophenylhydrazone | ChemIDplus |
| [(3-chlorophenyl)hydrazono]propanedinitrile | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11164 | KEGG COMPOUND |
| LSM-2341 | LINCS |
| Carbonyl_cyanide_m-chlorophenyl_hydrazone | Wikipedia |
| 2504 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1842102 | Beilstein |
| CAS:555-60-2 | KEGG COMPOUND |
| CAS:555-60-2 | ChemIDplus |
| Citations |
|---|