EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H5NS |
| Net Charge | 0 |
| Average Mass | 75.136 |
| Monoisotopic Mass | 75.01427 |
| SMILES | CC(N)=S |
| InChI | InChI=1S/C2H5NS/c1-2(3)4/h1H3,(H2,3,4) |
| InChIKey | YUKQRDCYNOVPGJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thioacetamide (CHEBI:32497) has functional parent acetamide (CHEBI:27856) |
| thioacetamide (CHEBI:32497) has role hepatotoxic agent (CHEBI:50908) |
| thioacetamide (CHEBI:32497) is a thiocarboxamide (CHEBI:47956) |
| IUPAC Name |
|---|
| ethanethioamide |
| Synonyms | Source |
|---|---|
| acetic acid thioamide | ChEBI |
| Acetothioamide | ChemIDplus |
| methylthioamide | ChEBI |
| TAA | NIST Chemistry WebBook |
| Thiacetamide | ChemIDplus |
| Thioacetimidic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C19302 | KEGG COMPOUND |
| Thioacetamide | Wikipedia |
| Citations |
|---|