EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H44N2 |
| Net Charge | 0 |
| Average Mass | 384.652 |
| Monoisotopic Mass | 384.35045 |
| SMILES | [H][C@@]12CC[C@]3([H])C(=CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@H](C)N)C=C1CC[C@H](N(C)C)C2(C)C |
| InChI | InChI=1S/C26H44N2/c1-17(27)20-13-15-26(5)22-10-9-21-18(16-19(22)12-14-25(20,26)4)8-11-23(28(6)7)24(21,2)3/h12,16-17,20-23H,8-11,13-15,27H2,1-7H3/t17-,20+,21+,22+,23-,25+,26-/m0/s1 |
| InChIKey | UVGUDMTZIJXYDY-XSWJKVCQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Buxamine E (CHEBI:3249) is a steroid alkaloid (CHEBI:26767) |
| Synonym | Source |
|---|---|
| Buxamine E | KEGG COMPOUND |