EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6NO2 |
| Net Charge | -1 |
| Average Mass | 88.086 |
| Monoisotopic Mass | 88.04040 |
| SMILES | C[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/p-1/t2-/m0/s1 |
| InChIKey | QNAYBMKLOCPYGJ-REOHCLBHSA-M |
| Roles Classification |
|---|
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-alaninate (CHEBI:32431) has role fundamental metabolite (CHEBI:78675) |
| L-alaninate (CHEBI:32431) is a L-α-amino acid anion (CHEBI:59814) |
| L-alaninate (CHEBI:32431) is a alaninate (CHEBI:32439) |
| L-alaninate (CHEBI:32431) is conjugate base of L-alanine (CHEBI:16977) |
| L-alaninate (CHEBI:32431) is enantiomer of D-alaninate (CHEBI:32435) |
| Incoming Relation(s) |
| 3-amino-L-alaninate (CHEBI:13043) has functional parent L-alaninate (CHEBI:32431) |
| L-alanine (CHEBI:16977) is conjugate acid of L-alaninate (CHEBI:32431) |
| D-alaninate (CHEBI:32435) is enantiomer of L-alaninate (CHEBI:32431) |
| IUPAC Name |
|---|
| L-alaninate |
| Synonyms | Source |
|---|---|
| (2S)-2-aminopropanoate | IUPAC |
| L-alanine anion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:324350 | Gmelin |
| Beilstein:4126899 | Beilstein |