EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O2 |
| Net Charge | 0 |
| Average Mass | 310.522 |
| Monoisotopic Mass | 310.28718 |
| SMILES | CCCCCCCCCC/C=C/CCCCCCCC(=O)O |
| InChI | InChI=1S/C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h11-12H,2-10,13-19H2,1H3,(H,21,22)/b12-11+ |
| InChIKey | LQJBNNIYVWPHFW-VAWYXSNFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gadelaidic acid (CHEBI:32422) is a 9-icosenoic acid (CHEBI:180273) |
| gadelaidic acid (CHEBI:32422) is conjugate acid of gadelaidate (CHEBI:32423) |
| Incoming Relation(s) |
| gadelaidate (CHEBI:32423) is conjugate base of gadelaidic acid (CHEBI:32422) |
| gadelaidoyl group (CHEBI:32424) is substituent group from gadelaidic acid (CHEBI:32422) |
| IUPAC Name |
|---|
| (9E)-icos-9-enoic acid |
| Synonyms | Source |
|---|---|
| 9t-Eicosensäure | ChEBI |
| (9E)-9-eicosenoic acid | ChEBI |
| (9E)-9-icosenoic acid | ChEBI |
| 9E-eicosenoic acid | LIPID MAPS |
| eicos-9t-enoic acid | ChEBI |
| Eicos-9t-ensäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030700 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1727309 | Reaxys |
| Citations |
|---|