EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5O2S |
| Net Charge | -1 |
| Average Mass | 141.171 |
| Monoisotopic Mass | 141.00157 |
| SMILES | O=C([O-])Cc1cccs1 |
| InChI | InChI=1S/C6H6O2S/c7-6(8)4-5-2-1-3-9-5/h1-3H,4H2,(H,7,8)/p-1 |
| InChIKey | SMJRBWINMFUUDS-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thien-2-ylacetate (CHEBI:32403) is a thiophenes (CHEBI:26961) |
| thien-2-ylacetate (CHEBI:32403) is conjugate base of 2-thienylacetic acid (CHEBI:45807) |
| Incoming Relation(s) |
| 2-thienylacetic acid (CHEBI:45807) is conjugate acid of thien-2-ylacetate (CHEBI:32403) |
| IUPAC Name |
|---|
| thiophen-2-ylacetate |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1006537 | Gmelin |
| Beilstein:4981394 | Beilstein |