EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O3 |
| Net Charge | -1 |
| Average Mass | 131.151 |
| Monoisotopic Mass | 131.07137 |
| SMILES | O=C([O-])CCCCCO |
| InChI | InChI=1S/C6H12O3/c7-5-3-1-2-4-6(8)9/h7H,1-5H2,(H,8,9)/p-1 |
| InChIKey | IWHLYPDWHHPVAA-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxyhexanoate (CHEBI:32383) has functional parent hexanoate (CHEBI:17120) |
| 6-hydroxyhexanoate (CHEBI:32383) is a ω-hydroxy-medium-chain fatty acid anion (CHEBI:194241) |
| 6-hydroxyhexanoate (CHEBI:32383) is conjugate base of 6-hydroxyhexanoic acid (CHEBI:17869) |
| Incoming Relation(s) |
| 6-hydroxyhexanoic acid (CHEBI:17869) is conjugate acid of 6-hydroxyhexanoate (CHEBI:32383) |
| IUPAC Name |
|---|
| 6-hydroxyhexanoate |
| Synonyms | Source |
|---|---|
| 5-hydroxypentanecarboxylate | ChEBI |
| 6-hydroxyhexanoic acid anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 6-hydroxyhexanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| c0013 | UM-BBD |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3661830 | Beilstein |
| CAS:1191-25-9 | UM-BBD |
| Citations |
|---|