EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O2 |
| Net Charge | 0 |
| Average Mass | 170.252 |
| Monoisotopic Mass | 170.13068 |
| SMILES | CCCCC/C=C\CCC(=O)O |
| InChI | InChI=1S/C10H18O2/c1-2-3-4-5-6-7-8-9-10(11)12/h6-7H,2-5,8-9H2,1H3,(H,11,12)/b7-6- |
| InChIKey | XKZKQTCECFWKBN-SREVYHEPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-4-decenoic acid (CHEBI:32380) is a decenoic acid (CHEBI:36003) |
| cis-4-decenoic acid (CHEBI:32380) is a ω−6 fatty acid (CHEBI:36009) |
| cis-4-decenoic acid (CHEBI:32380) is conjugate acid of cis-obtusilate (CHEBI:33161) |
| Incoming Relation(s) |
| cis-dec-4-enoyl-CoA (CHEBI:29140) has functional parent cis-4-decenoic acid (CHEBI:32380) |
| cis-obtusilate (CHEBI:33161) is conjugate base of cis-4-decenoic acid (CHEBI:32380) |
| obtusiloyl group (CHEBI:33162) is substituent group from cis-4-decenoic acid (CHEBI:32380) |
| IUPAC Name |
|---|
| (4Z)-dec-4-enoic acid |
| Synonyms | Source |
|---|---|
| cis-Δ4-decenoic acid | ChEBI |
| (Z)-4-decenoic acid | ChemIDplus |
| cis-obtusilic acid | ChEBI |
| 4-decenoic acid | ChemIDplus |
| C10:1 (n-6) | ChEBI |
| Z-4-decenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030199 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722691 | Reaxys |
| CAS:505-90-8 | ChemIDplus |
| Citations |
|---|