EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21O2 |
| Net Charge | -1 |
| Average Mass | 185.287 |
| Monoisotopic Mass | 185.15470 |
| SMILES | CCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C11H22O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2,1H3,(H,12,13)/p-1 |
| InChIKey | ZDPHROOEEOARMN-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| undecanoate (CHEBI:32369) has role human metabolite (CHEBI:77746) |
| undecanoate (CHEBI:32369) is a medium-chain fatty acid anion (CHEBI:59558) |
| undecanoate (CHEBI:32369) is a straight-chain saturated fatty acid anion (CHEBI:58954) |
| undecanoate (CHEBI:32369) is conjugate base of undecanoic acid (CHEBI:32368) |
| Incoming Relation(s) |
| undecanoic acid (CHEBI:32368) is conjugate acid of undecanoate (CHEBI:32369) |
| IUPAC Name |
|---|
| undecanoate |
| Synonyms | Source |
|---|---|
| 1-decanecarboxylate | ChEBI |
| CH3‒[CH2]9‒COO− | IUPAC |
| n-undecanoate | ChEBI |
| n-undecoate | ChEBI |
| n-undecylate | ChEBI |
| hendecanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| undecanoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:331364 | Gmelin |
| Beilstein:3904444 | Beilstein |
| Citations |
|---|