EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20O |
| Net Charge | 0 |
| Average Mass | 192.302 |
| Monoisotopic Mass | 192.15142 |
| SMILES | CC(=O)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h7-8H,5-6,9H2,1-4H3/b8-7+ |
| InChIKey | PSQYTAPXSHCGMF-BQYQJAHWSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-ionone (CHEBI:32325) has role antioxidant (CHEBI:22586) |
| β-ionone (CHEBI:32325) has role fragrance (CHEBI:48318) |
| β-ionone (CHEBI:32325) is a ionone (CHEBI:49248) |
| Incoming Relation(s) |
| (3R)-hydroxy-β-ionone (CHEBI:53173) has functional parent β-ionone (CHEBI:32325) |
| pseudoionone (CHEBI:67207) has functional parent β-ionone (CHEBI:32325) |
| β-ionone 5,6-epoxide (CHEBI:87546) has functional parent β-ionone (CHEBI:32325) |
| IUPAC Name |
|---|
| (3E)-4-(2,6,6-trimethylcyclohex-1-en-1-yl)but-3-en-2-one |
| Synonyms | Source |
|---|---|
| beta-Ionone | KEGG COMPOUND |
| (E)-beta-Ionone | ChemIDplus |
| (E)-β-Ionone | NIST Chemistry WebBook |
| trans-beta-Ionone | ChemIDplus |
| trans-β-Ionone | NIST Chemistry WebBook |
| β-E-Ionone | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| β-ionone | UniProt |
| Citations |
|---|