EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32316 - zotepine
| Formula | C18H18ClNOS |
| Net Charge | 0 |
| Average Mass | 331.868 |
| Monoisotopic Mass | 331.07976 |
| SMILES | CN(C)CCOC1=Cc2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H18ClNOS/c1-20(2)9-10-21-16-11-13-5-3-4-6-17(13)22-18-8-7-14(19)12-15(16)18/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | HDOZVRUNCMBHFH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | alpha-adrenergic drug Any drug that acts on an α-adrenergic receptor. |
| Applications: | alpha-adrenergic drug Any drug that acts on an α-adrenergic receptor. second generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be less likely than first generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zotepine (CHEBI:32316) has role second generation antipsychotic (CHEBI:65191) |
| zotepine (CHEBI:32316) has role serotonergic drug (CHEBI:48278) |
| zotepine (CHEBI:32316) has role α-adrenergic drug (CHEBI:48539) |
| zotepine (CHEBI:32316) is a dibenzothiepine (CHEBI:38924) |
| zotepine (CHEBI:32316) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-[(8-chlorodibenzo[b,f]thiepin-10-yl)oxy]-N,N-dimethylethanamine |
| INNs | Source |
|---|---|
| zotepina | ChemIDplus |
| zotepine | ChemIDplus |
| zotepinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-Chlor-11-(2-dimethylaminoaethoxy)-dibenzo(b,f)-thiepin | ChemIDplus |
| 2-Chloro-11-(2-(dimethylamino)ethoxy)dibenzo(b,f)thiepin | ChemIDplus |
| zotepine | IUPHAR |
| Brand Names | Source |
|---|---|
| Lodopin | ChemIDplus |
| Setous | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1435710 | Beilstein |
| CAS:26615-21-4 | ChemIDplus |
| CAS:26615-21-4 | KEGG DRUG |
| CAS:26615-21-4 | NIST Chemistry WebBook |