EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26ClNO2 |
| Net Charge | 0 |
| Average Mass | 311.853 |
| Monoisotopic Mass | 311.16521 |
| SMILES | CCCCOCN(C(=O)CCl)c1c(CC)cccc1CC |
| InChI | InChI=1S/C17H26ClNO2/c1-4-7-11-21-13-19(16(20)12-18)17-14(5-2)9-8-10-15(17)6-3/h8-10H,4-7,11-13H2,1-3H3 |
| InChIKey | HKPHPIREJKHECO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butachlor (CHEBI:3230) has functional parent N-phenylacetamide (CHEBI:28884) |
| butachlor (CHEBI:3230) has role environmental contaminant (CHEBI:78298) |
| butachlor (CHEBI:3230) has role herbicide (CHEBI:24527) |
| butachlor (CHEBI:3230) has role xenobiotic (CHEBI:35703) |
| butachlor (CHEBI:3230) is a aromatic amide (CHEBI:62733) |
| butachlor (CHEBI:3230) is a organochlorine compound (CHEBI:36683) |
| butachlor (CHEBI:3230) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| N-(butoxymethyl)-2-chloro-N-(2,6-diethylphenyl)acetamide |
| Synonyms | Source |
|---|---|
| 2-Chloro-2',6'-diethyl-N-(butoxymethyl)acetanilide | ChemIDplus |
| 2',6'-Diethyl-N-butoxymethyl-2-chloroacetanilide | NIST Chemistry WebBook |
| 2',6'-Diethyl-N-butoxymethyl-alpha-chloroacetanilide | ChemIDplus |
| N-(Butoxymethyl)-2-chloro-2',6'-diethylacetanilide | ChemIDplus |
| N-Butoxymethyl-alpha-chloro-2',6'-diethylacetanilide | ChemIDplus |
| UniProt Name | Source |
|---|---|
| butachlor | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2873811 | Reaxys |
| CAS:23184-66-9 | KEGG COMPOUND |
| CAS:23184-66-9 | ChemIDplus |
| CAS:23184-66-9 | NIST Chemistry WebBook |
| Citations |
|---|