EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N2O2 |
| Net Charge | 0 |
| Average Mass | 350.462 |
| Monoisotopic Mass | 350.19943 |
| SMILES | CCOC(=O)C1=C[C@]2(CC)CCCN3CCc4c(n1c1ccccc41)[C@@H]32 |
| InChI | InChI=1S/C22H26N2O2/c1-3-22-11-7-12-23-13-10-16-15-8-5-6-9-17(15)24(19(16)20(22)23)18(14-22)21(25)26-4-2/h5-6,8-9,14,20H,3-4,7,10-13H2,1-2H3/t20-,22+/m1/s1 |
| InChIKey | DDNCQMVWWZOMLN-IRLDBZIGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vinpocetine (CHEBI:32297) has role geroprotector (CHEBI:176497) |
| Vinpocetine (CHEBI:32297) is a alkaloid (CHEBI:22315) |
| Synonyms | Source |
|---|---|
| Vinpocetine | KEGG COMPOUND |
| bravinton | DrugCentral |
| ethyl apovincaminate tartrate | DrugCentral |
| vinporal | DrugCentral |
| apovincaminic acid ethyl ester | DrugCentral |
| ethyl apovincaminate | DrugCentral |
| Citations |
|---|