EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H54N4O8.2C4H6O6 |
| Net Charge | 0 |
| Average Mass | 1079.119 |
| Monoisotopic Mass | 1078.42704 |
| SMILES | O=C(O)[C@H](O)[C@@H](O)C(=O)O.O=C(O)[C@H](O)[C@@H](O)C(=O)O.[H][C@]12C=C(CC)CN(Cc3c(nc4ccccc34)[C@@](C(=O)OC)(c3cc4c(cc3OC)N(C)[C@]3([H])[C@]45CCN4CC=C[C@@](CC)([C@@H](OC(C)=O)[C@@]3(O)C(=O)OC)[C@]45[H])C1)C2 |
| InChI | InChI=1S/C45H54N4O8.2C4H6O6/c1-8-27-19-28-22-44(40(51)55-6,36-30(25-48(23-27)24-28)29-13-10-11-14-33(29)46-36)32-20-31-34(21-35(32)54-5)47(4)38-43(31)16-18-49-17-12-15-42(9-2,37(43)49)39(57-26(3)50)45(38,53)41(52)56-7;2*5-1(3(7)8)2(6)4(9)10/h10-15,19-21,28,37-39,46,53H,8-9,16-18,22-25H2,1-7H3;2*1-2,5-6H,(H,7,8)(H,9,10)/t28-,37-,38+,39+,42+,43+,44-,45+;2*1-,2-/m011/s1 |
| InChIKey | CILBMBUYJCWATM-IJDPFCGHSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vinorelbine L-tartrate (CHEBI:32296) has part vinorelbine (CHEBI:480999) |
| vinorelbine L-tartrate (CHEBI:32296) has role antineoplastic agent (CHEBI:35610) |
| vinorelbine L-tartrate (CHEBI:32296) is a tartrate salt (CHEBI:50562) |
| IUPAC Name |
|---|
| methyl (2β,3β,4β,5α,12β,19α)-4-acetoxy-15-[(6R,8S)-4-ethyl-8-(methoxycarbonyl)-1,3,6,7,8,9-hexahydro-2,6-methanoazecino[4,3-b]indol-8-yl]-3-hydroxy-16-methoxy-1-methyl-6,7-didehydroaspidospermidine-3-carboxylate (2R,3R)-2,3-dihydroxybutanedioate |
| Synonyms | Source |
|---|---|
| 3',4'-Didehydro-4'-deoxy-8'-norvincaleukoblastine L-(+)-tartrate (1:2) | ChemIDplus |
| Nor-5'-anhydrovinblastine ditartrate | ChemIDplus |
| Vinorelbine Bitartrate | DrugBank |
| Vinorelbine Ditartarate | DrugBank |
| Vinorelbine Ditartrate | DrugBank |
| Vinorelbine Tartrate | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| CN101037446 | Patent |
| CN1696135 | Patent |
| CN1839800 | Patent |
| D01935 | KEGG DRUG |
| DB00361 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7756070 | Reaxys |
| CAS:125317-39-7 | ChemIDplus |
| CAS:125317-39-7 | KEGG DRUG |
| Citations |
|---|