EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H55N5O7.H2O4S |
| Net Charge | 0 |
| Average Mass | 852.020 |
| Monoisotopic Mass | 851.37753 |
| SMILES | O=S(=O)(O)O.[H][C@@]12N(C)c3cc(OC)c([C@@]4(C(=O)OC)C[C@@H]5C[N@](CCc6c4nc4ccccc64)C[C@](O)(CC)C5)cc3[C@@]13CCN1CC=C[C@@](CC)([C@@H](O)[C@]2(O)C(N)=O)[C@]13[H] |
| InChI | InChI=1S/C43H55N5O7.H2O4S/c1-6-39(52)21-25-22-42(38(51)55-5,33-27(13-17-47(23-25)24-39)26-11-8-9-12-30(26)45-33)29-19-28-31(20-32(29)54-4)46(3)35-41(28)15-18-48-16-10-14-40(7-2,34(41)48)36(49)43(35,53)37(44)50;1-5(2,3)4/h8-12,14,19-20,25,34-36,45,49,52-53H,6-7,13,15-18,21-24H2,1-5H3,(H2,44,50);(H2,1,2,3,4)/t25-,34+,35-,36-,39+,40-,41-,42+,43+;/m1./s1 |
| InChIKey | COFJBSXICYYSKG-FJFFLIEUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vindesine sulfate (CHEBI:32295) has functional parent vindesine (CHEBI:36373) |
| vindesine sulfate (CHEBI:32295) has role antineoplastic agent (CHEBI:35610) |
| vindesine sulfate (CHEBI:32295) is a alkaloid sulfate salt (CHEBI:38013) |
| IUPAC Name |
|---|
| 3-carbamoyl-O4-deacetyl-3-de(methoxycarbonyl)vincaleukoblastine sulfate |
| Synonyms | Source |
|---|---|
| Fildesin (TN) | KEGG DRUG |
| Vindesine sulfate | KEGG DRUG |
| Vindesine sulfate salt | ChemIDplus |
| Desacetylvinblastine amide sulfate | ChemIDplus |
| Eldesine | ChemIDplus |
| 3-Carbamoyl-4-deacetyl-3-de(methoxycarbonyl)vincaleukoblastine sulfate (1:1) (salt) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01769 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:59917-39-4 | KEGG DRUG |
| CAS:59917-39-4 | ChemIDplus |