EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N2O3.Na |
| Net Charge | 0 |
| Average Mass | 234.231 |
| Monoisotopic Mass | 234.09804 |
| SMILES | CCC(C)C1(CC)C(=O)N=C([O-])NC1=O.[Na+] |
| InChI | InChI=1S/C10H16N2O3.Na/c1-4-6(3)10(5-2)7(13)11-9(15)12-8(10)14;/h6H,4-5H2,1-3H3,(H2,11,12,13,14,15);/q;+1/p-1 |
| InChIKey | QORQZMBCPRBCAB-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Application: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Butabarbital sodium (CHEBI:3229) is a barbiturates (CHEBI:22693) |
| Synonyms | Source |
|---|---|
| Astrudion | ChEMBL |
| Butabarbital sodium | KEGG COMPOUND |
| Butabarbital sodium salt | ChEMBL |
| Loubarb | ChEMBL |
| Mebutal | ChEMBL |
| NSC-11778 | ChEMBL |
| Brand Names | Source |
|---|---|
| Butalan | ChEMBL |
| Buticaps | ChEMBL |
| Butisol sodium | ChEMBL |
| Sarisol | ChEMBL |
| Sarisol no. 1 | ChEMBL |
| Sarisol no. 2 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00699 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:143-81-7 | KEGG COMPOUND |