EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29N5O3 |
| Net Charge | 0 |
| Average Mass | 387.484 |
| Monoisotopic Mass | 387.22704 |
| SMILES | COc1ccccc1N1CCN(CCCNc2cc(=O)n(C)c(=O)n2C)CC1 |
| InChI | InChI=1S/C20H29N5O3/c1-22-18(15-19(26)23(2)20(22)27)21-9-6-10-24-11-13-25(14-12-24)16-7-4-5-8-17(16)28-3/h4-5,7-8,15,21H,6,9-14H2,1-3H3 |
| InChIKey | ICMGLRUYEQNHPF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Urapidil (CHEBI:32278) has role antihypertensive agent (CHEBI:35674) |
| Urapidil (CHEBI:32278) is a piperazines (CHEBI:26144) |
| Synonyms | Source |
|---|---|
| ebrantil | DrugCentral |
| eupressyl | DrugCentral |
| mediatensyl | DrugCentral |
| NSC-310405 | ChEMBL |
| Urapidil | KEGG COMPOUND |
| urapidil HCl | DrugCentral |
| Citations |
|---|