EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O4 |
| Net Charge | 0 |
| Average Mass | 294.351 |
| Monoisotopic Mass | 294.15796 |
| SMILES | COc1cc(C(=O)NC2CCCNC2)cc(OC)c1OC |
| InChI | InChI=1S/C15H22N2O4/c1-19-12-7-10(8-13(20-2)14(12)21-3)15(18)17-11-5-4-6-16-9-11/h7-8,11,16H,4-6,9H2,1-3H3,(H,17,18) |
| InChIKey | YSIITVVESCNIPR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Troxipide (CHEBI:32271) has role anti-ulcer drug (CHEBI:49201) |
| Troxipide (CHEBI:32271) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| troxipida | WHO MedNet |
| Synonyms | Source |
|---|---|
| aplace | DrugCentral |
| KU-54 | DrugCentral |
| Troxipide | KEGG COMPOUND |
| Citations |
|---|