EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N2O3.2HCl |
| Net Charge | 0 |
| Average Mass | 339.263 |
| Monoisotopic Mass | 338.11640 |
| SMILES | COc1ccc(CN2CCNCC2)c(OC)c1OC.Cl.Cl |
| InChI | InChI=1S/C14H22N2O3.2ClH/c1-17-12-5-4-11(13(18-2)14(12)19-3)10-16-8-6-15-7-9-16;;/h4-5,15H,6-10H2,1-3H3;2*1H |
| InChIKey | VYFLPFGUVGMBEP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trimetazidine hydrochloride (CHEBI:32262) has role antineoplastic agent (CHEBI:35610) |
| Trimetazidine hydrochloride (CHEBI:32262) is a aromatic amine (CHEBI:33860) |
| Synonyms | Source |
|---|---|
| NSC-759317 | ChEMBL |
| Trimetazidine di-hcl | ChEMBL |
| trimetazidine dihydrochloride | ChEMBL |
| Trimetazidine dihydrochloride | KEGG COMPOUND |
| Trimetazidine hydrochloride | KEGG COMPOUND |
| Trimethazidine dihydrochloride | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D01606 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:13171-25-0 | KEGG COMPOUND |