EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32260 - trilostane
| Formula | C20H27NO3 |
| Net Charge | 0 |
| Average Mass | 329.440 |
| Monoisotopic Mass | 329.19909 |
| SMILES | [H][C@@]12CC[C@@]34O[C@@H]3C(O)=C(C#N)C[C@]4(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C20H27NO3/c1-18-7-6-14-12(13(18)3-4-15(18)22)5-8-20-17(24-20)16(23)11(10-21)9-19(14,20)2/h12-15,17,22-23H,3-9H2,1-2H3/t12-,13-,14-,15-,17+,18-,19+,20+/m0/s1 |
| InChIKey | KVJXBPDAXMEYOA-CXANFOAXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 1.1.1.210 [3beta(or 20alpha)-hydroxysteroid dehydrogenase] inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor which interferes with the action of 3β-hydroxysteroid dehydrogenase (EC 1.1.1.210), a group of steroidogenic enzymes. |
| Applications: | abortifacient A chemical substance that interrupts pregnancy after implantation. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trilostane (CHEBI:32260) has role abortifacient (CHEBI:50691) |
| trilostane (CHEBI:32260) has role antineoplastic agent (CHEBI:35610) |
| trilostane (CHEBI:32260) has role EC 1.1.1.210 [3β(or 20α)-hydroxysteroid dehydrogenase] inhibitor (CHEBI:50788) |
| trilostane (CHEBI:32260) is a 17β-hydroxy steroid (CHEBI:35343) |
| trilostane (CHEBI:32260) is a 3-hydroxy steroid (CHEBI:36834) |
| trilostane (CHEBI:32260) is a androstanoid (CHEBI:50402) |
| trilostane (CHEBI:32260) is a epoxy steroid (CHEBI:145217) |
| trilostane (CHEBI:32260) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| 3,17β-dihydroxy-4α,5-epoxy-5α-androst-2-ene-2-carbonitrile |
| INNs | Source |
|---|---|
| trilostane | ChemIDplus |
| trilostano | ChemIDplus |
| trilostanum | ChemIDplus |