EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N5 |
| Net Charge | 0 |
| Average Mass | 205.265 |
| Monoisotopic Mass | 205.13275 |
| SMILES | CCN(CC)c1cc(C)nc2ncnn12 |
| InChI | InChI=1S/C10H15N5/c1-4-14(5-2)9-6-8(3)13-10-11-7-12-15(9)10/h6-7H,4-5H2,1-3H3 |
| InChIKey | GSNOZLZNQMLSKJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trapidil (CHEBI:32254) has role cardiovascular drug (CHEBI:35554) |
| Trapidil (CHEBI:32254) is a triazolopyrimidines (CHEBI:48435) |
| Synonyms | Source |
|---|---|
| AR 12008 | ChEMBL |
| AR-12008 | ChEMBL |
| avantrin | DrugCentral |
| rocornal | DrugCentral |
| Trapidil | KEGG COMPOUND |
| trapymin | DrugCentral |
| Citations |
|---|