EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12ClNO2 |
| Net Charge | 0 |
| Average Mass | 261.708 |
| Monoisotopic Mass | 261.05566 |
| SMILES | Cc1c(Cl)cccc1Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C14H12ClNO2/c1-9-11(15)6-4-8-12(9)16-13-7-3-2-5-10(13)14(17)18/h2-8,16H,1H3,(H,17,18) |
| InChIKey | YEZNLOUZAIOMLT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. EC 2.7.1.33 (pantothenate kinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of pantothenate kinase (EC 2.7.1.33). |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolfenamic acid (CHEBI:32243) has functional parent anthranilic acid (CHEBI:30754) |
| tolfenamic acid (CHEBI:32243) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| tolfenamic acid (CHEBI:32243) has role EC 2.7.1.33 (pantothenate kinase) inhibitor (CHEBI:77194) |
| tolfenamic acid (CHEBI:32243) has role non-narcotic analgesic (CHEBI:35481) |
| tolfenamic acid (CHEBI:32243) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| tolfenamic acid (CHEBI:32243) is a aminobenzoic acid (CHEBI:22495) |
| tolfenamic acid (CHEBI:32243) is a organochlorine compound (CHEBI:36683) |
| tolfenamic acid (CHEBI:32243) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 2-[(3-chloro-2-methylphenyl)amino]benzoic acid |
| INNs | Source |
|---|---|
| acide tolfénamique | WHO MedNet |
| ácido tolfenámico | WHO MedNet |
| acidum tolfenamicum | ChemIDplus |
| tolfenamic acid | KEGG DRUG |
| Synonyms | Source |
|---|---|
| N-(2-Methyl-3-chlorophenyl)anthranilic acid | ChemIDplus |
| N-(3-Chloro-2-methylphenyl)anthranilic acid | ChemIDplus |
| N-(3-Chloro-o-tolyl)-anthranilic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1874 | VSDB |
| 2698 | DrugCentral |
| D01183 | KEGG DRUG |
| LSM-5612 | LINCS |
| Tolfenamic_acid | Wikipedia |
| US2003060465 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:657821 | Reaxys |
| CAS:13710-19-5 | ChemIDplus |
| CAS:13710-19-5 | KEGG DRUG |
| Citations |
|---|