EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21NOS |
| Net Charge | 0 |
| Average Mass | 323.461 |
| Monoisotopic Mass | 323.13439 |
| SMILES | Cc1cccc(N(C)C(=S)Oc2ccc3c(c2)C2CCC3C2)c1 |
| InChI | InChI=1S/C20H21NOS/c1-13-4-3-5-16(10-13)21(2)20(23)22-17-8-9-18-14-6-7-15(11-14)19(18)12-17/h3-5,8-10,12,14-15H,6-7,11H2,1-2H3 |
| InChIKey | CANCCLAKQQHLNK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tolciclate (CHEBI:32242) has role antifungal drug (CHEBI:86327) |
| Tolciclate (CHEBI:32242) is a monothiocarbamic ester (CHEBI:38128) |
| Synonyms | Source |
|---|---|
| fungifos | DrugCentral |
| kilmicen | DrugCentral |
| Tolciclate | KEGG COMPOUND |
| tolmicen | DrugCentral |