EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N2O4 |
| Net Charge | 0 |
| Average Mass | 382.460 |
| Monoisotopic Mass | 382.18926 |
| SMILES | CCC1C(C)=NN=C(c2ccc(OC)c(OC)c2)c2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C22H26N2O4/c1-7-15-13(2)23-24-22(14-8-9-18(25-3)19(10-14)26-4)17-12-21(28-6)20(27-5)11-16(15)17/h8-12,15H,7H2,1-6H3 |
| InChIKey | RUJBDQSFYCKFAA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tofisopam (CHEBI:32241) has role anxiolytic drug (CHEBI:35474) |
| Tofisopam (CHEBI:32241) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| emandaxin | DrugCentral |
| grandaxin | DrugCentral |
| seriel | DrugCentral |
| Tofisopam | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2693 | DrugCentral |
| D01254 | KEGG DRUG |
| HMDB0015699 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:22345-47-7 | KEGG COMPOUND |
| Citations |
|---|